C7H14N2OS — CID 167005513
(4R)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-2-ol (PubChem CID 167005513) has the molecular formula C7H14N2OS and a molecular weight of 174.27 g/mol. Its IUPAC name is (4R)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-2-ol.
| Compound Name | (4R)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-2-ol |
|---|---|
| PubChem CID | 167005513 |
| Molecular Formula | C7H14N2OS |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (4R)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-2-ol |
| SMILES | CC[C@H]1SCC2NC(O)NC21 |
| InChI | InChI=1S/C7H14N2OS/c1-2-5-6-4(3-11-5)8-7(10)9-6/h4-10H,2-3H2,1H3/t4?,5-,6?,7?/m1/s1 |
| InChIKey | XLNFKFXPBRSYLO-BWZSGCSDSA-N |
| XLogP | -0.28 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |