C10H17N3O2S — CID 163454621
3-[2-[(1R,7S,8S)-4-oxa-9-thia-2,6-diazatricyclo[5.3.0.03,5]decan-8-yl]ethyl]oxiran-2-amine (PubChem CID 163454621) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 3-[2-[(1R,7S,8S)-4-oxa-9-thia-2,6-diazatricyclo[5.3.0.03,5]decan-8-yl]ethyl]oxiran-2-amine.
| Compound Name | 3-[2-[(1R,7S,8S)-4-oxa-9-thia-2,6-diazatricyclo[5.3.0.03,5]decan-8-yl]ethyl]oxiran-2-amine |
|---|---|
| PubChem CID | 163454621 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-[2-[(1R,7S,8S)-4-oxa-9-thia-2,6-diazatricyclo[5.3.0.03,5]decan-8-yl]ethyl]oxiran-2-amine |
| SMILES | NC1OC1CC[C@@H]1SC[C@@H]2NC3OC3N[C@@H]21 |
| InChI | InChI=1S/C10H17N3O2S/c11-8-5(14-8)1-2-6-7-4(3-16-6)12-9-10(13-7)15-9/h4-10,12-13H,1-3,11H2/t4-,5?,6-,7-,8?,9?,10?/m0/s1 |
| InChIKey | BJJUAWHIIHNMGR-FLFDDBGZSA-N |
| XLogP | -0.82 |
| TPSA | 75.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|