C17H16N6O — CID 167006725
2-nitroso-4-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1H-benzimidazol-2-yl]aniline (PubChem CID 167006725) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-nitroso-4-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1H-benzimidazol-2-yl]aniline.
| Compound Name | 2-nitroso-4-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1H-benzimidazol-2-yl]aniline |
|---|---|
| PubChem CID | 167006725 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-nitroso-4-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1H-benzimidazol-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc3ccc(C4=NCCCN4)cc3[nH]2)cc1N=O |
| InChI | InChI=1S/C17H16N6O/c18-12-4-2-11(8-14(12)23-24)17-21-13-5-3-10(9-15(13)22-17)16-19-6-1-7-20-16/h2-5,8-9H,1,6-7,18H2,(H,19,20)(H,21,22) |
| InChIKey | SRECBXKBGQVTCW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|