C43H31N3O — CID 167008222
N'-(N-benzyl-C-phenanthren-2-ylcarbonimidoyl)-8-cyclohepta-1,4,6-trien-1-yl-N-methylidenedibenzofuran-1-carboximidamide (PubChem CID 167008222) has the molecular formula C43H31N3O and a molecular weight of 605.74 g/mol. Its IUPAC name is N'-(N-benzyl-C-phenanthren-2-ylcarbonimidoyl)-8-cyclohepta-1,4,6-trien-1-yl-N-methylidenedibenzofuran-1-carboximidamide.
| Compound Name | N'-(N-benzyl-C-phenanthren-2-ylcarbonimidoyl)-8-cyclohepta-1,4,6-trien-1-yl-N-methylidenedibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 167008222 |
| Molecular Formula | C43H31N3O |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | N'-(N-benzyl-C-phenanthren-2-ylcarbonimidoyl)-8-cyclohepta-1,4,6-trien-1-yl-N-methylidenedibenzofuran-1-carboximidamide |
| SMILES | C=N/C(=N/C(=N/Cc1ccccc1)c1ccc2c(ccc3ccccc32)c1)c1cccc2oc3ccc(C4=CCC=CC=C4)cc3c12 |
| InChI | InChI=1S/C43H31N3O/c1-44-43(37-18-11-19-40-41(37)38-27-32(23-25-39(38)47-40)30-14-7-2-3-8-15-30)46-42(45-28-29-12-5-4-6-13-29)34-22-24-36-33(26-34)21-20-31-16-9-10-17-35(31)36/h2-7,9-27H,1,8,28H2/b45-42+,46-43+ |
| InChIKey | FUHFPGCALQYUNW-WAZLLKRFSA-N |
| XLogP | 10.89 |
| TPSA | 50.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|