C29H28N4O3 — CID 167008549
3-[7-(1-benzyl-4-ethenylpiperidin-4-yl)-3-oxo-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-2-yl]piperidine-2,6-dione (PubChem CID 167008549) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is 3-[7-(1-benzyl-4-ethenylpiperidin-4-yl)-3-oxo-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-(1-benzyl-4-ethenylpiperidin-4-yl)-3-oxo-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167008549 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 3-[7-(1-benzyl-4-ethenylpiperidin-4-yl)-3-oxo-2,9-diazatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-2-yl]piperidine-2,6-dione |
| SMILES | C=CC1(c2ccc3c4c(ccnc24)N(C2CCC(=O)NC2=O)C3=O)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H28N4O3/c1-2-29(13-16-32(17-14-29)18-19-6-4-3-5-7-19)21-9-8-20-25-22(12-15-30-26(21)25)33(28(20)36)23-10-11-24(34)31-27(23)35/h2-9,12,15,23H,1,10-11,13-14,16-18H2,(H,31,34,35) |
| InChIKey | NDUVNNAPFBCSLO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|