C11H14N2O — CID 167010027
4-ethynyl-1-N-(2-methoxyethyl)benzene-1,2-diamine (PubChem CID 167010027) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-ethynyl-1-N-(2-methoxyethyl)benzene-1,2-diamine.
| Compound Name | 4-ethynyl-1-N-(2-methoxyethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 167010027 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 4-ethynyl-1-N-(2-methoxyethyl)benzene-1,2-diamine |
| SMILES | C#Cc1ccc(NCCOC)c(N)c1 |
| InChI | InChI=1S/C11H14N2O/c1-3-9-4-5-11(10(12)8-9)13-6-7-14-2/h1,4-5,8,13H,6-7,12H2,2H3 |
| InChIKey | CRIOVGVGUVXWJU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|