C18H19NO3 — CID 167013190
4-cyclopentyl-2-(3,6-dihydro-2H-pyran-3-yl)isoindole-1,3-dione (PubChem CID 167013190) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 4-cyclopentyl-2-(3,6-dihydro-2H-pyran-3-yl)isoindole-1,3-dione.
| Compound Name | 4-cyclopentyl-2-(3,6-dihydro-2H-pyran-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167013190 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 4-cyclopentyl-2-(3,6-dihydro-2H-pyran-3-yl)isoindole-1,3-dione |
| SMILES | O=C1c2cccc(C3CCCC3)c2C(=O)N1C1C=CCOC1 |
| InChI | InChI=1S/C18H19NO3/c20-17-15-9-3-8-14(12-5-1-2-6-12)16(15)18(21)19(17)13-7-4-10-22-11-13/h3-4,7-9,12-13H,1-2,5-6,10-11H2 |
| InChIKey | PESCNBYDYPCRKA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|