C15H13Cl2N5S — CID 167014555
2,5-dichloro-N-(1-methylsulfanyl-2,3-dihydroindol-7-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 167014555) has the molecular formula C15H13Cl2N5S and a molecular weight of 366.28 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-methylsulfanyl-2,3-dihydroindol-7-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-(1-methylsulfanyl-2,3-dihydroindol-7-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 167014555 |
| Molecular Formula | C15H13Cl2N5S |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 2,5-dichloro-N-(1-methylsulfanyl-2,3-dihydroindol-7-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CSN1CCc2cccc(Nc3nc(Cl)nc4[nH]cc(Cl)c34)c21 |
| InChI | InChI=1S/C15H13Cl2N5S/c1-23-22-6-5-8-3-2-4-10(12(8)22)19-14-11-9(16)7-18-13(11)20-15(17)21-14/h2-4,7H,5-6H2,1H3,(H2,18,19,20,21) |
| InChIKey | HBVFZFMAMPHJND-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|