C20H25N3O2 — CID 167022079
N-[N-ethenyl-C-[2-(2-oxopyrrolidin-1-yl)hex-5-enyl]carbonimidoyl]benzamide (PubChem CID 167022079) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[N-ethenyl-C-[2-(2-oxopyrrolidin-1-yl)hex-5-enyl]carbonimidoyl]benzamide.
| Compound Name | N-[N-ethenyl-C-[2-(2-oxopyrrolidin-1-yl)hex-5-enyl]carbonimidoyl]benzamide |
|---|---|
| PubChem CID | 167022079 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[N-ethenyl-C-[2-(2-oxopyrrolidin-1-yl)hex-5-enyl]carbonimidoyl]benzamide |
| SMILES | C=CCCC(C/C(=N\C=C)NC(=O)c1ccccc1)N1CCCC1=O |
| InChI | InChI=1S/C20H25N3O2/c1-3-5-12-17(23-14-9-13-19(23)24)15-18(21-4-2)22-20(25)16-10-7-6-8-11-16/h3-4,6-8,10-11,17H,1-2,5,9,12-15H2,(H,21,22,25) |
| InChIKey | HXIMPWHRMICJBL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|