C19H21ClN2O3S — CID 167024087
7-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-2,3-dihydro-1,3-benzoxazol-2-ol (PubChem CID 167024087) has the molecular formula C19H21ClN2O3S and a molecular weight of 392.91 g/mol. Its IUPAC name is 7-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-2,3-dihydro-1,3-benzoxazol-2-ol.
| Compound Name | 7-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-2,3-dihydro-1,3-benzoxazol-2-ol |
|---|---|
| PubChem CID | 167024087 |
| Molecular Formula | C19H21ClN2O3S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 7-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-2,3-dihydro-1,3-benzoxazol-2-ol |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cccc4c3OC(O)N4)N1)OCCc1cc(Cl)sc12 |
| InChI | InChI=1S/C19H21ClN2O3S/c1-10-8-19(17-11(5-6-24-19)7-15(20)26-17)9-14(21-10)12-3-2-4-13-16(12)25-18(23)22-13/h2-4,7,10,14,18,21-23H,5-6,8-9H2,1H3/t10-,14-,18?,19-/m0/s1 |
| InChIKey | VAFJSVWPWRYVSV-TWJYUAGZSA-N |
| XLogP | 3.76 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |