C9H14OS — CID 167024927
3-ethenyl-3a,4,5,6,7,7a-hexahydro-3H-benzo[d]oxathiole (PubChem CID 167024927) has the molecular formula C9H14OS and a molecular weight of 170.28 g/mol. Its IUPAC name is 3-ethenyl-3a,4,5,6,7,7a-hexahydro-3H-benzo[d]oxathiole.
| Compound Name | 3-ethenyl-3a,4,5,6,7,7a-hexahydro-3H-benzo[d]oxathiole |
|---|---|
| PubChem CID | 167024927 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 3-ethenyl-3a,4,5,6,7,7a-hexahydro-3H-benzo[d]oxathiole |
| SMILES | C=CC1SOC2CCCCC21 |
| InChI | InChI=1S/C9H14OS/c1-2-9-7-5-3-4-6-8(7)10-11-9/h2,7-9H,1,3-6H2 |
| InChIKey | JUCGSFCNWBOVCE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|