C17H18N2O4 — CID 167025785
methyl 2-[8-(2-methoxy-2-oxoethyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9-pentaen-8-yl]acetate (PubChem CID 167025785) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is methyl 2-[8-(2-methoxy-2-oxoethyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9-pentaen-8-yl]acetate.
| Compound Name | methyl 2-[8-(2-methoxy-2-oxoethyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9-pentaen-8-yl]acetate |
|---|---|
| PubChem CID | 167025785 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | methyl 2-[8-(2-methoxy-2-oxoethyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9-pentaen-8-yl]acetate |
| SMILES | COC(=O)CC1(CC(=O)OC)C2=CCCN=C2c2ncccc21 |
| InChI | InChI=1S/C17H18N2O4/c1-22-13(20)9-17(10-14(21)23-2)11-5-3-7-18-15(11)16-12(17)6-4-8-19-16/h3,5-7H,4,8-10H2,1-2H3 |
| InChIKey | QMKMQYUMWGHUEH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |