C14H12ClF3O3S — CID 167032496
methyl 1-chloro-5-(trifluoromethylsulfanyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate (PubChem CID 167032496) has the molecular formula C14H12ClF3O3S and a molecular weight of 352.76 g/mol. Its IUPAC name is methyl 1-chloro-5-(trifluoromethylsulfanyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate.
| Compound Name | methyl 1-chloro-5-(trifluoromethylsulfanyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
|---|---|
| PubChem CID | 167032496 |
| Molecular Formula | C14H12ClF3O3S |
| Molecular Weight | 352.76 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | methyl 1-chloro-5-(trifluoromethylsulfanyloxy)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1Cl)CCCC=C2OSC(F)(F)F |
| InChI | InChI=1S/C14H12ClF3O3S/c1-20-13(19)10-7-6-8-9(12(10)15)4-2-3-5-11(8)21-22-14(16,17)18/h5-7H,2-4H2,1H3 |
| InChIKey | TYMWBQOMJBHZSP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.76 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|