About dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate
dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate (PubChem CID 167041194) has the molecular formula C21H26N2O6
and a molecular weight of 402.45 g/mol. Its IUPAC name is dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate |
| PubChem CID | 167041194 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate |
| SMILES | COC(=O)CCC(C(=O)OC)N1C(=O)c2cc(OC3CC(N)C3)ccc2C12CC2 |
| InChI | InChI=1S/C21H26N2O6/c1-27-18(24)6-5-17(20(26)28-2)23-19(25)15-11-13(29-14-9-12(22)10-14)3-4-16(15)21(23)7-8-21/h3-4,11-12,14,17H,5-10,22H2,1-2H3 |
| InChIKey | AXPALRAQMYASND-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate?
The IUPAC name of dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate (CID 167041194) is dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate.
What is the SMILES notation for dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate?
The canonical SMILES for dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate is COC(=O)CCC(C(=O)OC)N1C(=O)c2cc(OC3CC(N)C3)ccc2C12CC2.
What is the InChIKey of dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate?
The InChIKey is AXPALRAQMYASND-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O6/c1-27-18(24)6-5-17(20(26)28-2)23-19(25)15-11-13(29-14-9-12(22)10-14)3-4-16(15)21(23)7-8-21/h3-4,11-12,14,17H,5-10,22H2,1-2H3.
What are the key properties of dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate?
dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate has a molecular weight of 402.45 g/mol, XLogP of 1.49, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[5'-(3-aminocyclobutyl)oxy-3'-oxospiro[cyclopropane-1,1'-isoindole]-2'-yl]pentanedioate is sourced from PubChem (CID 167041194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).