C15H21N — CID 167042846
2-tert-butyl-5-prop-1-en-2-yl-1,3-dihydroisoindole (PubChem CID 167042846) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-tert-butyl-5-prop-1-en-2-yl-1,3-dihydroisoindole.
| Compound Name | 2-tert-butyl-5-prop-1-en-2-yl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 167042846 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 2-tert-butyl-5-prop-1-en-2-yl-1,3-dihydroisoindole |
| SMILES | C=C(C)c1ccc2c(c1)CN(C(C)(C)C)C2 |
| InChI | InChI=1S/C15H21N/c1-11(2)12-6-7-13-9-16(15(3,4)5)10-14(13)8-12/h6-8H,1,9-10H2,2-5H3 |
| InChIKey | MQDOHFGGIXBRAF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |