C17H27NO — CID 167046317
(3Z,5E,6E,8E)-8-ethenyl-5-(2-propoxyethylidene)deca-3,6,8-trien-1-amine (PubChem CID 167046317) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (3Z,5E,6E,8E)-8-ethenyl-5-(2-propoxyethylidene)deca-3,6,8-trien-1-amine.
| Compound Name | (3Z,5E,6E,8E)-8-ethenyl-5-(2-propoxyethylidene)deca-3,6,8-trien-1-amine |
|---|---|
| PubChem CID | 167046317 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (3Z,5E,6E,8E)-8-ethenyl-5-(2-propoxyethylidene)deca-3,6,8-trien-1-amine |
| SMILES | C=CC(/C=C/C(/C=C\CCN)=C/COCCC)=C\C |
| InChI | InChI=1S/C17H27NO/c1-4-14-19-15-12-17(9-7-8-13-18)11-10-16(5-2)6-3/h5-7,9-12H,2,4,8,13-15,18H2,1,3H3/b9-7-,11-10+,16-6+,17-12+ |
| InChIKey | CZUWKLPDTQHUMD-MBXZEYOBSA-N |
| XLogP | 3.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|