C12H23NO2 — CID 167048594
(E)-4-(4-ethenoxybutoxy)-N,N-dimethylbut-3-en-1-amine (PubChem CID 167048594) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is (E)-4-(4-ethenoxybutoxy)-N,N-dimethylbut-3-en-1-amine.
| Compound Name | (E)-4-(4-ethenoxybutoxy)-N,N-dimethylbut-3-en-1-amine |
|---|---|
| PubChem CID | 167048594 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (E)-4-(4-ethenoxybutoxy)-N,N-dimethylbut-3-en-1-amine |
| SMILES | C=COCCCCO/C=C/CCN(C)C |
| InChI | InChI=1S/C12H23NO2/c1-4-14-10-7-8-12-15-11-6-5-9-13(2)3/h4,6,11H,1,5,7-10,12H2,2-3H3/b11-6+ |
| InChIKey | LCZRHNMLJXRJTM-IZZDOVSWSA-N |
| XLogP | 2.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|