C10H21NO — CID 90709463
N,N-dimethyl-3-(3-methylbut-1-enoxy)propan-1-amine (PubChem CID 90709463) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is N,N-dimethyl-3-(3-methylbut-1-enoxy)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(3-methylbut-1-enoxy)propan-1-amine |
|---|---|
| PubChem CID | 90709463 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | N,N-dimethyl-3-(3-methylbut-1-enoxy)propan-1-amine |
| SMILES | CC(C)C=COCCCN(C)C |
| InChI | InChI=1S/C10H21NO/c1-10(2)6-9-12-8-5-7-11(3)4/h6,9-10H,5,7-8H2,1-4H3 |
| InChIKey | TYHPKKPMEZSHGQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|