C13H22O — CID 88539087
(1E,3Z,5E)-1-butoxy-7-methylocta-1,3,5-triene (PubChem CID 88539087) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (1E,3Z,5E)-1-butoxy-7-methylocta-1,3,5-triene.
| Compound Name | (1E,3Z,5E)-1-butoxy-7-methylocta-1,3,5-triene |
|---|---|
| PubChem CID | 88539087 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (1E,3Z,5E)-1-butoxy-7-methylocta-1,3,5-triene |
| SMILES | CCCCO/C=C/C=C\C=C\C(C)C |
| InChI | InChI=1S/C13H22O/c1-4-5-11-14-12-9-7-6-8-10-13(2)3/h6-10,12-13H,4-5,11H2,1-3H3/b7-6-,10-8+,12-9+ |
| InChIKey | ZQJOAWYYOHAFLG-IFLWPJKESA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|