About 6-fluoro-N,N,9-trimethyldec-7-en-1-amine
6-fluoro-N,N,9-trimethyldec-7-en-1-amine (PubChem CID 167278138) has the molecular formula C13H26FN
and a molecular weight of 215.36 g/mol. Its IUPAC name is 6-fluoro-N,N,9-trimethyldec-7-en-1-amine.
Molecular Properties
| Compound Name | 6-fluoro-N,N,9-trimethyldec-7-en-1-amine |
| PubChem CID | 167278138 |
| Molecular Formula | C13H26FN |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 6-fluoro-N,N,9-trimethyldec-7-en-1-amine |
| SMILES | CC(C)C=CC(F)CCCCCN(C)C |
| InChI | InChI=1S/C13H26FN/c1-12(2)9-10-13(14)8-6-5-7-11-15(3)4/h9-10,12-13H,5-8,11H2,1-4H3 |
| InChIKey | MNDMWGADEUKYIB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-N,N,9-trimethyldec-7-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N,N,9-trimethyldec-7-en-1-amine?
The IUPAC name of 6-fluoro-N,N,9-trimethyldec-7-en-1-amine (CID 167278138) is 6-fluoro-N,N,9-trimethyldec-7-en-1-amine.
What is the SMILES notation for 6-fluoro-N,N,9-trimethyldec-7-en-1-amine?
The canonical SMILES for 6-fluoro-N,N,9-trimethyldec-7-en-1-amine is CC(C)C=CC(F)CCCCCN(C)C.
What is the InChIKey of 6-fluoro-N,N,9-trimethyldec-7-en-1-amine?
The InChIKey is MNDMWGADEUKYIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26FN/c1-12(2)9-10-13(14)8-6-5-7-11-15(3)4/h9-10,12-13H,5-8,11H2,1-4H3.
What are the key properties of 6-fluoro-N,N,9-trimethyldec-7-en-1-amine?
6-fluoro-N,N,9-trimethyldec-7-en-1-amine has a molecular weight of 215.36 g/mol, XLogP of 3.66, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N,N,9-trimethyldec-7-en-1-amine is sourced from PubChem (CID 167278138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).