C34H17N7O4S5 — CID 167051554
benzyl 4,11-bis[5-(dicyanomethylideneamino)-3-methoxythiophen-2-yl]-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14-carboxylate (PubChem CID 167051554) has the molecular formula C34H17N7O4S5 and a molecular weight of 747.89 g/mol. Its IUPAC name is benzyl 4,11-bis[5-(dicyanomethylideneamino)-3-methoxythiophen-2-yl]-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14-carboxylate.
| Compound Name | benzyl 4,11-bis[5-(dicyanomethylideneamino)-3-methoxythiophen-2-yl]-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14-carboxylate |
|---|---|
| PubChem CID | 167051554 |
| Molecular Formula | C34H17N7O4S5 |
| Molecular Weight | 747.89 g/mol |
| Exact Mass | 746.99 |
| IUPAC Name | benzyl 4,11-bis[5-(dicyanomethylideneamino)-3-methoxythiophen-2-yl]-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14-carboxylate |
| SMILES | COc1cc(N=C(C#N)C#N)sc1-c1cc2c(s1)c1sc3cc(-c4sc(N=C(C#N)C#N)cc4OC)sc3c1n2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H17N7O4S5/c1-43-21-9-26(39-18(12-35)13-36)49-30(21)23-8-20-29(46-23)33-28(41(20)34(42)45-16-17-6-4-3-5-7-17)32-25(48-33)11-24(47-32)31-22(44-2)10-27(50-31)40-19(14-37)15-38/h3-11H,16H2,1-2H3 |
| InChIKey | NAROJMDLRLVOES-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 169.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.89 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|