C15H17N3O — CID 167065383
5H-1,4-benzodiazepin-8-yl(piperidin-1-yl)methanone (PubChem CID 167065383) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 5H-1,4-benzodiazepin-8-yl(piperidin-1-yl)methanone.
| Compound Name | 5H-1,4-benzodiazepin-8-yl(piperidin-1-yl)methanone |
|---|---|
| PubChem CID | 167065383 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 5H-1,4-benzodiazepin-8-yl(piperidin-1-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)N=CC=NC2)N1CCCCC1 |
| InChI | InChI=1S/C15H17N3O/c19-15(18-8-2-1-3-9-18)12-4-5-13-11-16-6-7-17-14(13)10-12/h4-7,10H,1-3,8-9,11H2 |
| InChIKey | BFHFSNIWWBEGTE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |