C17H18FN3OS2 — CID 167069112
(4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol (PubChem CID 167069112) has the molecular formula C17H18FN3OS2 and a molecular weight of 363.48 g/mol. Its IUPAC name is (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol.
| Compound Name | (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 167069112 |
| Molecular Formula | C17H18FN3OS2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol |
| SMILES | OC(Nc1ccc(F)cc1)c1cc2nc(N3CCCCC3)sc2s1 |
| InChI | InChI=1S/C17H18FN3OS2/c18-11-4-6-12(7-5-11)19-15(22)14-10-13-16(23-14)24-17(20-13)21-8-2-1-3-9-21/h4-7,10,15,19,22H,1-3,8-9H2 |
| InChIKey | XQIWEHHBGOPXKY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|