About (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol
(4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol (PubChem CID 167069112) has the molecular formula C17H18FN3OS2
and a molecular weight of 363.48 g/mol. Its IUPAC name is (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol |
| PubChem CID | 167069112 |
| Molecular Formula | C17H18FN3OS2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol |
| SMILES | OC(Nc1ccc(F)cc1)c1cc2nc(N3CCCCC3)sc2s1 |
| InChI | InChI=1S/C17H18FN3OS2/c18-11-4-6-12(7-5-11)19-15(22)14-10-13-16(23-14)24-17(20-13)21-8-2-1-3-9-21/h4-7,10,15,19,22H,1-3,8-9H2 |
| InChIKey | XQIWEHHBGOPXKY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol?
The IUPAC name of (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol (CID 167069112) is (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol.
What is the SMILES notation for (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol?
The canonical SMILES for (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol is OC(Nc1ccc(F)cc1)c1cc2nc(N3CCCCC3)sc2s1.
What is the InChIKey of (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol?
The InChIKey is XQIWEHHBGOPXKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN3OS2/c18-11-4-6-12(7-5-11)19-15(22)14-10-13-16(23-14)24-17(20-13)21-8-2-1-3-9-21/h4-7,10,15,19,22H,1-3,8-9H2.
What are the key properties of (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol?
(4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol has a molecular weight of 363.48 g/mol, XLogP of 4.59, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoroanilino)-(2-piperidin-1-ylthieno[3,2-d][1,3]thiazol-5-yl)methanol is sourced from PubChem (CID 167069112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).