C17H18N4S2 — CID 155310989
N'-phenyl-2-piperidin-1-ylthieno[3,2-d][1,3]thiazole-5-carboximidamide (PubChem CID 155310989) has the molecular formula C17H18N4S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is N'-phenyl-2-piperidin-1-ylthieno[3,2-d][1,3]thiazole-5-carboximidamide.
| Compound Name | N'-phenyl-2-piperidin-1-ylthieno[3,2-d][1,3]thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 155310989 |
| Molecular Formula | C17H18N4S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N'-phenyl-2-piperidin-1-ylthieno[3,2-d][1,3]thiazole-5-carboximidamide |
| SMILES | N/C(=N\c1ccccc1)c1cc2nc(N3CCCCC3)sc2s1 |
| InChI | InChI=1S/C17H18N4S2/c18-15(19-12-7-3-1-4-8-12)14-11-13-16(22-14)23-17(20-13)21-9-5-2-6-10-21/h1,3-4,7-8,11H,2,5-6,9-10H2,(H2,18,19) |
| InChIKey | QUBNUVCSRNICED-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|