About 12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene
12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene (PubChem CID 167070735) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene.
Molecular Properties
| Compound Name | 12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene |
| PubChem CID | 167070735 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene |
| SMILES | CC1=NNC=C2CCCCCCCCCC21 |
| InChI | InChI=1S/C14H24N2/c1-12-14-10-8-6-4-2-3-5-7-9-13(14)11-15-16-12/h11,14-15H,2-10H2,1H3 |
| InChIKey | KNIBBNAPLYBVGM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene?
The IUPAC name of 12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene (CID 167070735) is 12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene.
What is the SMILES notation for 12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene?
The canonical SMILES for 12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene is CC1=NNC=C2CCCCCCCCCC21.
What is the InChIKey of 12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene?
The InChIKey is KNIBBNAPLYBVGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2/c1-12-14-10-8-6-4-2-3-5-7-9-13(14)11-15-16-12/h11,14-15H,2-10H2,1H3.
What are the key properties of 12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene?
12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene has a molecular weight of 220.36 g/mol, XLogP of 3.99, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-methyl-13,14-diazabicyclo[9.4.0]pentadeca-1(15),12-diene is sourced from PubChem (CID 167070735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).