C43H39NO — CID 167072450
(E)-N-(1-cyclohexa-2,4-dien-1-ylethenyl)-3-[3-cyclohexa-2,4-dien-1-yl-5-[(1E,3Z)-hexa-1,3,5-trienyl]-4-methylphenyl]-1-dibenzofuran-3-ylbut-2-en-1-imine (PubChem CID 167072450) has the molecular formula C43H39NO and a molecular weight of 585.79 g/mol. Its IUPAC name is (E)-N-(1-cyclohexa-2,4-dien-1-ylethenyl)-3-[3-cyclohexa-2,4-dien-1-yl-5-[(1E,3Z)-hexa-1,3,5-trienyl]-4-methylphenyl]-1-dibenzofuran-3-ylbut-2-en-1-imine.
| Compound Name | (E)-N-(1-cyclohexa-2,4-dien-1-ylethenyl)-3-[3-cyclohexa-2,4-dien-1-yl-5-[(1E,3Z)-hexa-1,3,5-trienyl]-4-methylphenyl]-1-dibenzofuran-3-ylbut-2-en-1-imine |
|---|---|
| PubChem CID | 167072450 |
| Molecular Formula | C43H39NO |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | (E)-N-(1-cyclohexa-2,4-dien-1-ylethenyl)-3-[3-cyclohexa-2,4-dien-1-yl-5-[(1E,3Z)-hexa-1,3,5-trienyl]-4-methylphenyl]-1-dibenzofuran-3-ylbut-2-en-1-imine |
| SMILES | C=C/C=C\C=C\c1cc(/C(C)=C/C(=N/C(=C)C2C=CC=CC2)c2ccc3c(c2)oc2ccccc23)cc(C2C=CC=CC2)c1C |
| InChI | InChI=1S/C43H39NO/c1-5-6-7-10-21-35-27-37(28-40(31(35)3)34-19-13-9-14-20-34)30(2)26-41(44-32(4)33-17-11-8-12-18-33)36-24-25-39-38-22-15-16-23-42(38)45-43(39)29-36/h5-17,19,21-29,33-34H,1,4,18,20H2,2-3H3/b7-6-,21-10+,30-26+,44-41- |
| InChIKey | VJRIFICHZSOSGK-QNAQFMKQSA-N |
| XLogP | 11.79 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|