C22H21NO — CID 167072457
1-dibenzofuran-3-yl-N-[(4Z,6Z)-octa-1,4,6-trien-2-yl]ethanimine (PubChem CID 167072457) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-dibenzofuran-3-yl-N-[(4Z,6Z)-octa-1,4,6-trien-2-yl]ethanimine.
| Compound Name | 1-dibenzofuran-3-yl-N-[(4Z,6Z)-octa-1,4,6-trien-2-yl]ethanimine |
|---|---|
| PubChem CID | 167072457 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-dibenzofuran-3-yl-N-[(4Z,6Z)-octa-1,4,6-trien-2-yl]ethanimine |
| SMILES | C=C(C/C=C\C=C/C)/N=C(\C)c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C22H21NO/c1-4-5-6-7-10-16(2)23-17(3)18-13-14-20-19-11-8-9-12-21(19)24-22(20)15-18/h4-9,11-15H,2,10H2,1,3H3/b5-4-,7-6-,23-17+ |
| InChIKey | VJCCMBOXMKKCIZ-WKKXNJCGSA-N |
| XLogP | 6.43 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|