C22H19NO — CID 167072413
1-dibenzofuran-3-yl-N-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]ethanimine (PubChem CID 167072413) has the molecular formula C22H19NO and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-dibenzofuran-3-yl-N-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]ethanimine.
| Compound Name | 1-dibenzofuran-3-yl-N-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]ethanimine |
|---|---|
| PubChem CID | 167072413 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-dibenzofuran-3-yl-N-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]ethanimine |
| SMILES | C=C/C=C(\C=C)C(=C)/N=C(\C)c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C22H19NO/c1-5-9-17(6-2)15(3)23-16(4)18-12-13-20-19-10-7-8-11-21(19)24-22(20)14-18/h5-14H,1-3H2,4H3/b17-9+,23-16+ |
| InChIKey | XDDZWHRPAKZWCD-JZEVRDPQSA-N |
| XLogP | 6.21 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|