C14H18FN5O4PS+ — CID 167072674
[(2R,3R,4R,5R)-5-[6-[[(E)-but-2-enyl]amino]purin-9-yl]-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]oxy-oxo-sulfanylphosphanium (PubChem CID 167072674) has the molecular formula C14H18FN5O4PS+ and a molecular weight of 402.37 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[6-[[(E)-but-2-enyl]amino]purin-9-yl]-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]oxy-oxo-sulfanylphosphanium.
| Compound Name | [(2R,3R,4R,5R)-5-[6-[[(E)-but-2-enyl]amino]purin-9-yl]-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]oxy-oxo-sulfanylphosphanium |
|---|---|
| PubChem CID | 167072674 |
| Molecular Formula | C14H18FN5O4PS+ |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[6-[[(E)-but-2-enyl]amino]purin-9-yl]-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]oxy-oxo-sulfanylphosphanium |
| SMILES | C/C=C/CNc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O[P+](=O)S)[C@H]1F |
| InChI | InChI=1S/C14H17FN5O4PS/c1-2-3-4-16-12-10-13(18-6-17-12)20(7-19-10)14-9(15)11(24-25(22)26)8(5-21)23-14/h2-3,6-9,11,14,21H,4-5H2,1H3,(H-,16,17,18,22,26)/p+1/b3-2+/t8-,9-,11-,14-/m1/s1 |
| InChIKey | QRVOWGVULGOCIT-MDGKUSRWSA-O |
| XLogP | 2.01 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|