C20H22N2O — CID 167073852
13-cyclohexa-1,3-dien-1-yl-3-methyl-16-oxa-4,14-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,8,10(15),11-tetraene (PubChem CID 167073852) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 13-cyclohexa-1,3-dien-1-yl-3-methyl-16-oxa-4,14-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,8,10(15),11-tetraene.
| Compound Name | 13-cyclohexa-1,3-dien-1-yl-3-methyl-16-oxa-4,14-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,8,10(15),11-tetraene |
|---|---|
| PubChem CID | 167073852 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 13-cyclohexa-1,3-dien-1-yl-3-methyl-16-oxa-4,14-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1,8,10(15),11-tetraene |
| SMILES | CC1NCC2CC=c3c4c(oc3=C21)NC(C1=CC=CCC1)C=C4 |
| InChI | InChI=1S/C20H22N2O/c1-12-18-14(11-21-12)7-8-15-16-9-10-17(13-5-3-2-4-6-13)22-20(16)23-19(15)18/h2-3,5,8-10,12,14,17,21-22H,4,6-7,11H2,1H3 |
| InChIKey | QKIZWIVJAYGROA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |