C15H11F5O4S — CID 167079785
1,2,3,4-tetrafluoro-5-[(3-fluoro-4-methoxyphenoxy)methyl]-6-methylsulfonylbenzene (PubChem CID 167079785) has the molecular formula C15H11F5O4S and a molecular weight of 382.31 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoro-5-[(3-fluoro-4-methoxyphenoxy)methyl]-6-methylsulfonylbenzene.
| Compound Name | 1,2,3,4-tetrafluoro-5-[(3-fluoro-4-methoxyphenoxy)methyl]-6-methylsulfonylbenzene |
|---|---|
| PubChem CID | 167079785 |
| Molecular Formula | C15H11F5O4S |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 1,2,3,4-tetrafluoro-5-[(3-fluoro-4-methoxyphenoxy)methyl]-6-methylsulfonylbenzene |
| SMILES | COc1ccc(OCc2c(F)c(F)c(F)c(F)c2S(C)(=O)=O)cc1F |
| InChI | InChI=1S/C15H11F5O4S/c1-23-10-4-3-7(5-9(10)16)24-6-8-11(17)12(18)13(19)14(20)15(8)25(2,21)22/h3-5H,6H2,1-2H3 |
| InChIKey | RBSOZAUXCSTPNT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|