C34H49N3O5S — CID 167081003
(16S,17R)-16-[dimethylsulfamoyl-[(4-methoxyphenyl)methyl]amino]-14-methyl-19-oxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2,4,6(25)-trien-12-one (PubChem CID 167081003) has the molecular formula C34H49N3O5S and a molecular weight of 611.85 g/mol. Its IUPAC name is (16S,17R)-16-[dimethylsulfamoyl-[(4-methoxyphenyl)methyl]amino]-14-methyl-19-oxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2,4,6(25)-trien-12-one.
| Compound Name | (16S,17R)-16-[dimethylsulfamoyl-[(4-methoxyphenyl)methyl]amino]-14-methyl-19-oxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2,4,6(25)-trien-12-one |
|---|---|
| PubChem CID | 167081003 |
| Molecular Formula | C34H49N3O5S |
| Molecular Weight | 611.85 g/mol |
| Exact Mass | 611.34 |
| IUPAC Name | (16S,17R)-16-[dimethylsulfamoyl-[(4-methoxyphenyl)methyl]amino]-14-methyl-19-oxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2,4,6(25)-trien-12-one |
| SMILES | COc1ccc(CN([C@H]2CC(C)N3C(=O)CCCCCc4cccc(c4)C4CCC(CC4)OC[C@@H]23)S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C34H49N3O5S/c1-25-21-32(36(43(39,40)35(2)3)23-27-13-17-30(41-4)18-14-27)33-24-42-31-19-15-28(16-20-31)29-11-8-10-26(22-29)9-6-5-7-12-34(38)37(25)33/h8,10-11,13-14,17-18,22,25,28,31-33H,5-7,9,12,15-16,19-21,23-24H2,1-4H3/t25?,28?,31?,32-,33-/m0/s1 |
| InChIKey | WWEDESJVIHYBSB-MLRGVPBISA-N |
| XLogP | 5.52 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.85 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |