C32H45N3O7S — CID 170655661
(14R,16S,17R)-16-[dimethylsulfamoyl-[(4-methoxyphenyl)methyl]amino]-14-methyl-7,11,19-trioxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-12-one (PubChem CID 170655661) has the molecular formula C32H45N3O7S and a molecular weight of 615.79 g/mol. Its IUPAC name is (14R,16S,17R)-16-[dimethylsulfamoyl-[(4-methoxyphenyl)methyl]amino]-14-methyl-7,11,19-trioxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-12-one.
| Compound Name | (14R,16S,17R)-16-[dimethylsulfamoyl-[(4-methoxyphenyl)methyl]amino]-14-methyl-7,11,19-trioxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-12-one |
|---|---|
| PubChem CID | 170655661 |
| Molecular Formula | C32H45N3O7S |
| Molecular Weight | 615.79 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | (14R,16S,17R)-16-[dimethylsulfamoyl-[(4-methoxyphenyl)methyl]amino]-14-methyl-7,11,19-trioxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-12-one |
| SMILES | COc1ccc(CN([C@H]2C[C@@H](C)N3C(=O)OCCCOc4cccc(c4)C4CCC(CC4)OC[C@@H]23)S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C32H45N3O7S/c1-23-19-30(34(43(37,38)33(2)3)21-24-9-13-27(39-4)14-10-24)31-22-42-28-15-11-25(12-16-28)26-7-5-8-29(20-26)40-17-6-18-41-32(36)35(23)31/h5,7-10,13-14,20,23,25,28,30-31H,6,11-12,15-19,21-22H2,1-4H3/t23-,25?,28?,30+,31+/m1/s1 |
| InChIKey | RUGSQTXQPXYJFA-HXAKGJTISA-N |
| XLogP | 4.80 |
| TPSA | 97.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.79 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |