C22H32N2O5S — CID 170655711
N-[(2S,8R,9S)-14-oxo-6,18-dioxa-13-azatetracyclo[17.3.1.12,5.08,13]tetracosa-1(23),19,21-trien-9-yl]methanesulfonamide (PubChem CID 170655711) has the molecular formula C22H32N2O5S and a molecular weight of 436.57 g/mol. Its IUPAC name is N-[(2S,8R,9S)-14-oxo-6,18-dioxa-13-azatetracyclo[17.3.1.12,5.08,13]tetracosa-1(23),19,21-trien-9-yl]methanesulfonamide.
| Compound Name | N-[(2S,8R,9S)-14-oxo-6,18-dioxa-13-azatetracyclo[17.3.1.12,5.08,13]tetracosa-1(23),19,21-trien-9-yl]methanesulfonamide |
|---|---|
| PubChem CID | 170655711 |
| Molecular Formula | C22H32N2O5S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[(2S,8R,9S)-14-oxo-6,18-dioxa-13-azatetracyclo[17.3.1.12,5.08,13]tetracosa-1(23),19,21-trien-9-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCN2C(=O)CCCOc3cccc(c3)[C@H]3CCC(C3)OC[C@@H]12 |
| InChI | InChI=1S/C22H32N2O5S/c1-30(26,27)23-20-7-3-11-24-21(20)15-29-19-10-9-17(14-19)16-5-2-6-18(13-16)28-12-4-8-22(24)25/h2,5-6,13,17,19-21,23H,3-4,7-12,14-15H2,1H3/t17-,19?,20-,21-/m0/s1 |
| InChIKey | MAPOQQYUWQQBTO-QOKQSESGSA-N |
| XLogP | 2.42 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |