C21H31N3O4S — CID 156687861
N-[(15S)-10-oxo-18-oxa-8,11-diazatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide (PubChem CID 156687861) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is N-[(15S)-10-oxo-18-oxa-8,11-diazatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide.
| Compound Name | N-[(15S)-10-oxo-18-oxa-8,11-diazatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide |
|---|---|
| PubChem CID | 156687861 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[(15S)-10-oxo-18-oxa-8,11-diazatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCN2C(=O)CNc3ccccc3C3CCC(CC3)OCC12 |
| InChI | InChI=1S/C21H31N3O4S/c1-29(26,27)23-19-7-4-12-24-20(19)14-28-16-10-8-15(9-11-16)17-5-2-3-6-18(17)22-13-21(24)25/h2-3,5-6,15-16,19-20,22-23H,4,7-14H2,1H3/t15?,16?,19-,20?/m0/s1 |
| InChIKey | OMPYCTRKFYTHSW-PUFPBPQXSA-N |
| XLogP | 2.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |