C22H32N2O5S — CID 167117665
N-[(16R)-3-methyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide (PubChem CID 167117665) has the molecular formula C22H32N2O5S and a molecular weight of 436.57 g/mol. Its IUPAC name is N-[(16R)-3-methyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide.
| Compound Name | N-[(16R)-3-methyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide |
|---|---|
| PubChem CID | 167117665 |
| Molecular Formula | C22H32N2O5S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[(16R)-3-methyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide |
| SMILES | Cc1cccc2c1C1CCC(CC1)OC[C@H]1C(NS(C)(=O)=O)CCCN1C(=O)CO2 |
| InChI | InChI=1S/C22H32N2O5S/c1-15-5-3-7-20-22(15)16-8-10-17(11-9-16)28-13-19-18(23-30(2,26)27)6-4-12-24(19)21(25)14-29-20/h3,5,7,16-19,23H,4,6,8-14H2,1-2H3/t16?,17?,18?,19-/m0/s1 |
| InChIKey | MRIRRFKTHCUIIX-LFVBFMBRSA-N |
| XLogP | 2.34 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |