C21H29FN2O5S — CID 164799240
1-fluoro-N-[(15S,16R)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide (PubChem CID 164799240) has the molecular formula C21H29FN2O5S and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-fluoro-N-[(15S,16R)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide.
| Compound Name | 1-fluoro-N-[(15S,16R)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide |
|---|---|
| PubChem CID | 164799240 |
| Molecular Formula | C21H29FN2O5S |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1-fluoro-N-[(15S,16R)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide |
| SMILES | O=C1COc2ccccc2C2CCC(CC2)OC[C@H]2[C@@H](NS(=O)(=O)CF)CCCN12 |
| InChI | InChI=1S/C21H29FN2O5S/c22-14-30(26,27)23-18-5-3-11-24-19(18)12-28-16-9-7-15(8-10-16)17-4-1-2-6-20(17)29-13-21(24)25/h1-2,4,6,15-16,18-19,23H,3,5,7-14H2/t15?,16?,18-,19-/m0/s1 |
| InChIKey | ZFXQCMWZTSXXMJ-VHZYLWGESA-N |
| XLogP | 2.33 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |