C22H32N2O5S — CID 167145840
N-[(15S,16R)-5-methyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2(7),3,5-trien-15-yl]methanesulfonamide (PubChem CID 167145840) has the molecular formula C22H32N2O5S and a molecular weight of 436.57 g/mol. Its IUPAC name is N-[(15S,16R)-5-methyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2(7),3,5-trien-15-yl]methanesulfonamide.
| Compound Name | N-[(15S,16R)-5-methyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2(7),3,5-trien-15-yl]methanesulfonamide |
|---|---|
| PubChem CID | 167145840 |
| Molecular Formula | C22H32N2O5S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[(15S,16R)-5-methyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2(7),3,5-trien-15-yl]methanesulfonamide |
| SMILES | Cc1ccc2c(c1)OCC(=O)N1CCC[C@H](NS(C)(=O)=O)[C@@H]1COC1CCC2CC1 |
| InChI | InChI=1S/C22H32N2O5S/c1-15-5-10-18-16-6-8-17(9-7-16)28-13-20-19(23-30(2,26)27)4-3-11-24(20)22(25)14-29-21(18)12-15/h5,10,12,16-17,19-20,23H,3-4,6-9,11,13-14H2,1-2H3/t16?,17?,19-,20-/m0/s1 |
| InChIKey | FAMPYHNIAWZZKW-WXDAQCLHSA-N |
| XLogP | 2.34 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |