C21H28F2N2O5S — CID 167117543
1,1-difluoro-N-[(16R)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide (PubChem CID 167117543) has the molecular formula C21H28F2N2O5S and a molecular weight of 458.53 g/mol. Its IUPAC name is 1,1-difluoro-N-[(16R)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide.
| Compound Name | 1,1-difluoro-N-[(16R)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide |
|---|---|
| PubChem CID | 167117543 |
| Molecular Formula | C21H28F2N2O5S |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 1,1-difluoro-N-[(16R)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide |
| SMILES | O=C1COc2ccccc2C2CCC(CC2)OC[C@H]2C(NS(=O)(=O)C(F)F)CCCN12 |
| InChI | InChI=1S/C21H28F2N2O5S/c22-21(23)31(27,28)24-17-5-3-11-25-18(17)12-29-15-9-7-14(8-10-15)16-4-1-2-6-19(16)30-13-20(25)26/h1-2,4,6,14-15,17-18,21,24H,3,5,7-13H2/t14?,15?,17?,18-/m0/s1 |
| InChIKey | QAURZPKJYPLCGF-CSQARDAQSA-N |
| XLogP | 2.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |