C26H36N2O5 — CID 171437794
N-[(15S)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]oxane-2-carboxamide (PubChem CID 171437794) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is N-[(15S)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]oxane-2-carboxamide.
| Compound Name | N-[(15S)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]oxane-2-carboxamide |
|---|---|
| PubChem CID | 171437794 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | N-[(15S)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]oxane-2-carboxamide |
| SMILES | O=C(N[C@H]1CCCN2C(=O)COc3ccccc3C3CCC(CC3)OCC12)C1CCCCO1 |
| InChI | InChI=1S/C26H36N2O5/c29-25-17-33-23-8-2-1-6-20(23)18-10-12-19(13-11-18)32-16-22-21(7-5-14-28(22)25)27-26(30)24-9-3-4-15-31-24/h1-2,6,8,18-19,21-22,24H,3-5,7,9-17H2,(H,27,30)/t18?,19?,21-,22?,24?/m0/s1 |
| InChIKey | RILGCFSCFIBKHH-UGXDDMJDSA-N |
| XLogP | 3.17 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |