C24H36N2O5S — CID 167117691
(2R)-N-(10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl)butane-2-sulfonamide (PubChem CID 167117691) has the molecular formula C24H36N2O5S and a molecular weight of 464.63 g/mol. Its IUPAC name is (2R)-N-(10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl)butane-2-sulfonamide.
| Compound Name | (2R)-N-(10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl)butane-2-sulfonamide |
|---|---|
| PubChem CID | 167117691 |
| Molecular Formula | C24H36N2O5S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (2R)-N-(10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl)butane-2-sulfonamide |
| SMILES | CC[C@@H](C)S(=O)(=O)NC1CCCN2C(=O)COc3ccccc3C3CCC(CC3)OCC12 |
| InChI | InChI=1S/C24H36N2O5S/c1-3-17(2)32(28,29)25-21-8-6-14-26-22(21)15-30-19-12-10-18(11-13-19)20-7-4-5-9-23(20)31-16-24(26)27/h4-5,7,9,17-19,21-22,25H,3,6,8,10-16H2,1-2H3/t17-,18?,19?,21?,22?/m1/s1 |
| InChIKey | IAEUQRMWQDWRRX-XPYPBCPKSA-N |
| XLogP | 3.20 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |