C23H32N2O5 — CID 171437807
2-methoxy-N-[(15S)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]acetamide (PubChem CID 171437807) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-methoxy-N-[(15S)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]acetamide.
| Compound Name | 2-methoxy-N-[(15S)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]acetamide |
|---|---|
| PubChem CID | 171437807 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 2-methoxy-N-[(15S)-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]acetamide |
| SMILES | COCC(=O)N[C@H]1CCCN2C(=O)COc3ccccc3C3CCC(CC3)OCC12 |
| InChI | InChI=1S/C23H32N2O5/c1-28-14-22(26)24-19-6-4-12-25-20(19)13-29-17-10-8-16(9-11-17)18-5-2-3-7-21(18)30-15-23(25)27/h2-3,5,7,16-17,19-20H,4,6,8-15H2,1H3,(H,24,26)/t16?,17?,19-,20?/m0/s1 |
| InChIKey | KFLJFWZTQVNXPG-JLYZFGFVSA-N |
| XLogP | 2.24 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |