C21H30N5O5S+ — CID 171608098
N-[(18S)-13-oxo-11,21-dioxa-7,9,14-triaza-4-azoniapentacyclo[20.2.2.02,10.04,8.014,19]hexacosa-2,4,7,9-tetraen-18-yl]methanesulfonamide (PubChem CID 171608098) has the molecular formula C21H30N5O5S+ and a molecular weight of 464.57 g/mol. Its IUPAC name is N-[(18S)-13-oxo-11,21-dioxa-7,9,14-triaza-4-azoniapentacyclo[20.2.2.02,10.04,8.014,19]hexacosa-2,4,7,9-tetraen-18-yl]methanesulfonamide.
| Compound Name | N-[(18S)-13-oxo-11,21-dioxa-7,9,14-triaza-4-azoniapentacyclo[20.2.2.02,10.04,8.014,19]hexacosa-2,4,7,9-tetraen-18-yl]methanesulfonamide |
|---|---|
| PubChem CID | 171608098 |
| Molecular Formula | C21H30N5O5S+ |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[(18S)-13-oxo-11,21-dioxa-7,9,14-triaza-4-azoniapentacyclo[20.2.2.02,10.04,8.014,19]hexacosa-2,4,7,9-tetraen-18-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCN2C(=O)COc3nc4[n+](cc3C3CCC(CC3)OCC12)=CCN=4 |
| InChI | InChI=1S/C21H30N5O5S/c1-32(28,29)24-17-3-2-9-26-18(17)12-30-15-6-4-14(5-7-15)16-11-25-10-8-22-21(25)23-20(16)31-13-19(26)27/h10-11,14-15,17-18,24H,2-9,12-13H2,1H3/q+1/t14?,15?,17-,18?/m0/s1 |
| InChIKey | JYNFSOOBUNBICA-OQJBAJDCSA-N |
| XLogP | -0.64 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|