C20H29N3O5S — CID 167117575
N-[(15R)-3-methyl-10-oxo-8,17-dioxa-6,11-diazatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-yl]methanesulfonamide (PubChem CID 167117575) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-[(15R)-3-methyl-10-oxo-8,17-dioxa-6,11-diazatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-yl]methanesulfonamide.
| Compound Name | N-[(15R)-3-methyl-10-oxo-8,17-dioxa-6,11-diazatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-yl]methanesulfonamide |
|---|---|
| PubChem CID | 167117575 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-[(15R)-3-methyl-10-oxo-8,17-dioxa-6,11-diazatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-yl]methanesulfonamide |
| SMILES | Cc1ccnc2c1C1CCC(CC1)OC[C@H]1C(NS(C)(=O)=O)CCN1C(=O)CO2 |
| InChI | InChI=1S/C20H29N3O5S/c1-13-7-9-21-20-19(13)14-3-5-15(6-4-14)27-11-17-16(22-29(2,25)26)8-10-23(17)18(24)12-28-20/h7,9,14-17,22H,3-6,8,10-12H2,1-2H3/t14?,15?,16?,17-/m0/s1 |
| InChIKey | BSATUOXETBWQTB-GZUIOVLMSA-N |
| XLogP | 1.34 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |