C22H34N2O4S — CID 167117621
N-[(16R)-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]ethanesulfonamide (PubChem CID 167117621) has the molecular formula C22H34N2O4S and a molecular weight of 422.59 g/mol. Its IUPAC name is N-[(16R)-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]ethanesulfonamide.
| Compound Name | N-[(16R)-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 167117621 |
| Molecular Formula | C22H34N2O4S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-[(16R)-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1CCCN2CCOc3ccccc3C3CCC(CC3)OC[C@@H]12 |
| InChI | InChI=1S/C22H34N2O4S/c1-2-29(25,26)23-20-7-5-13-24-14-15-27-22-8-4-3-6-19(22)17-9-11-18(12-10-17)28-16-21(20)24/h3-4,6,8,17-18,20-21,23H,2,5,7,9-16H2,1H3/t17?,18?,20?,21-/m0/s1 |
| InChIKey | BNUDRHCMQZVBMN-QDDLRWIDSA-N |
| XLogP | 2.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |