C22H34N2O4S — CID 156687909
N-[(9S,14S)-9-ethyl-8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-yl]methanesulfonamide (PubChem CID 156687909) has the molecular formula C22H34N2O4S and a molecular weight of 422.59 g/mol. Its IUPAC name is N-[(9S,14S)-9-ethyl-8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-yl]methanesulfonamide.
| Compound Name | N-[(9S,14S)-9-ethyl-8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-yl]methanesulfonamide |
|---|---|
| PubChem CID | 156687909 |
| Molecular Formula | C22H34N2O4S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-[(9S,14S)-9-ethyl-8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-yl]methanesulfonamide |
| SMILES | CC[C@H]1CN2CC[C@H](NS(C)(=O)=O)C2COC2CCC(CC2)c2ccccc2O1 |
| InChI | InChI=1S/C22H34N2O4S/c1-3-17-14-24-13-12-20(23-29(2,25)26)21(24)15-27-18-10-8-16(9-11-18)19-6-4-5-7-22(19)28-17/h4-7,16-18,20-21,23H,3,8-15H2,1-2H3/t16?,17-,18?,20-,21?/m0/s1 |
| InChIKey | LGMIOUFDXQXWLS-PEKTXGOLSA-N |
| XLogP | 2.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |