C21H32N2O3S — CID 156747318
N-[(9R,14S,15R)-9-methyl-8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-yl]methanesulfinamide (PubChem CID 156747318) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is N-[(9R,14S,15R)-9-methyl-8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-yl]methanesulfinamide.
| Compound Name | N-[(9R,14S,15R)-9-methyl-8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-yl]methanesulfinamide |
|---|---|
| PubChem CID | 156747318 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-[(9R,14S,15R)-9-methyl-8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-yl]methanesulfinamide |
| SMILES | C[C@@H]1CN2CC[C@H](NS(C)=O)[C@@H]2COC2CCC(CC2)c2ccccc2O1 |
| InChI | InChI=1S/C21H32N2O3S/c1-15-13-23-12-11-19(22-27(2)24)20(23)14-25-17-9-7-16(8-10-17)18-5-3-4-6-21(18)26-15/h3-6,15-17,19-20,22H,7-14H2,1-2H3/t15-,16?,17?,19+,20+,27?/m1/s1 |
| InChIKey | FKVFHGCZLAQTCK-ZBPWQOJDSA-N |
| XLogP | 2.84 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |