C23H34N2O5S — CID 156687839
N-[(15S)-9,9-dimethyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide (PubChem CID 156687839) has the molecular formula C23H34N2O5S and a molecular weight of 450.60 g/mol. Its IUPAC name is N-[(15S)-9,9-dimethyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide.
| Compound Name | N-[(15S)-9,9-dimethyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide |
|---|---|
| PubChem CID | 156687839 |
| Molecular Formula | C23H34N2O5S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | N-[(15S)-9,9-dimethyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide |
| SMILES | CC1(C)Oc2ccccc2C2CCC(CC2)OCC2[C@@H](NS(C)(=O)=O)CCCN2C1=O |
| InChI | InChI=1S/C23H34N2O5S/c1-23(2)22(26)25-14-6-8-19(24-31(3,27)28)20(25)15-29-17-12-10-16(11-13-17)18-7-4-5-9-21(18)30-23/h4-5,7,9,16-17,19-20,24H,6,8,10-15H2,1-3H3/t16?,17?,19-,20?/m0/s1 |
| InChIKey | XTOPJAYQRKYHKA-JLYZFGFVSA-N |
| XLogP | 2.81 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |