C25H38N2O4S — CID 167117590
1-cyclobutyl-N-[(16R)-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide (PubChem CID 167117590) has the molecular formula C25H38N2O4S and a molecular weight of 462.66 g/mol. Its IUPAC name is 1-cyclobutyl-N-[(16R)-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide.
| Compound Name | 1-cyclobutyl-N-[(16R)-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide |
|---|---|
| PubChem CID | 167117590 |
| Molecular Formula | C25H38N2O4S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 1-cyclobutyl-N-[(16R)-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-yl]methanesulfonamide |
| SMILES | O=S(=O)(CC1CCC1)NC1CCCN2CCOc3ccccc3C3CCC(CC3)OC[C@@H]12 |
| InChI | InChI=1S/C25H38N2O4S/c28-32(29,18-19-5-3-6-19)26-23-8-4-14-27-15-16-30-25-9-2-1-7-22(25)20-10-12-21(13-11-20)31-17-24(23)27/h1-2,7,9,19-21,23-24,26H,3-6,8,10-18H2/t20?,21?,23?,24-/m0/s1 |
| InChIKey | KXTDKVKWFQPSNN-QZPRJYCFSA-N |
| XLogP | 3.67 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |