C23H34N2O5S — CID 167080926
N-(13-methyl-11-oxo-7,18-dioxa-12-azatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-trien-15-yl)methanesulfonamide (PubChem CID 167080926) has the molecular formula C23H34N2O5S and a molecular weight of 450.60 g/mol. Its IUPAC name is N-(13-methyl-11-oxo-7,18-dioxa-12-azatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-trien-15-yl)methanesulfonamide.
| Compound Name | N-(13-methyl-11-oxo-7,18-dioxa-12-azatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-trien-15-yl)methanesulfonamide |
|---|---|
| PubChem CID | 167080926 |
| Molecular Formula | C23H34N2O5S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | N-(13-methyl-11-oxo-7,18-dioxa-12-azatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-trien-15-yl)methanesulfonamide |
| SMILES | CC1CC(NS(C)(=O)=O)C2COC3CCC(CC3)c3cccc(c3)OCCCC(=O)N12 |
| InChI | InChI=1S/C23H34N2O5S/c1-16-13-21(24-31(2,27)28)22-15-30-19-10-8-17(9-11-19)18-5-3-6-20(14-18)29-12-4-7-23(26)25(16)22/h3,5-6,14,16-17,19,21-22,24H,4,7-13,15H2,1-2H3 |
| InChIKey | ZFGQEGOPOIJPRH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |